CymitQuimica logo

CAS 47592-74-5

:

N(alpha)-boc-N(epsilon)-(2-bromo-Z)-L-lysine

Description:
N(alpha)-Boc-N(epsilon)-(2-bromo-Z)-L-lysine is a derivative of the amino acid lysine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group at the alpha amino group and a brominated Z (Z isomer of the double bond) side chain. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to facilitate the formation of peptide bonds while protecting the amino and carboxyl functionalities. The bromine atom in the side chain can serve as a reactive site for further chemical modifications, making it a versatile intermediate in organic synthesis. The Boc group is commonly used to protect amines during chemical reactions, allowing for selective reactions at other functional groups. The compound's structure contributes to its solubility and stability under various conditions, which is essential for its application in laboratory settings. Overall, N(alpha)-Boc-N(epsilon)-(2-bromo-Z)-L-lysine is a valuable compound in synthetic organic chemistry, particularly in the development of peptide-based therapeutics.
Formula:C19H27BrN2O6
InChI:InChI=1/C19H27BrN2O6/c1-19(2,3)28-18(26)22-15(16(23)24)10-6-7-11-21-17(25)27-12-13-8-4-5-9-14(13)20/h4-5,8-9,15H,6-7,10-12H2,1-3H3,(H,21,25)(H,22,26)(H,23,24)/t15-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CCCCN=C(O)OCc1ccccc1Br)C(=O)O)O
Synonyms:
  • Boc-Lys(2-bromo-Z)-OH
  • Boc-Lys(2-Br-Z)-OH
  • (2S)-6-[(2-bromophenyl)methoxycarbonylamino]-2-(tert-butoxycarbonylamino)hexanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.