CymitQuimica logo

CAS 475994-57-1

:

7,8-Difluoroisoquinoline

Description:
7,8-Difluoroisoquinoline is a heterocyclic organic compound characterized by the presence of a fused benzene and pyridine ring system, specifically substituted with two fluorine atoms at the 7 and 8 positions of the isoquinoline structure. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties, which contribute to its stability and reactivity. The presence of fluorine atoms enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and drug development. 7,8-Difluoroisoquinoline may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-withdrawing nature of the fluorine substituents. Its unique structure allows for potential applications in the synthesis of pharmaceuticals, agrochemicals, and other functional materials. As with many fluorinated compounds, it is essential to handle 7,8-difluoroisoquinoline with care, considering its potential environmental and health impacts.
Formula:C9H5F2N
InChI:InChI=1S/C9H5F2N/c10-8-2-1-6-3-4-12-5-7(6)9(8)11/h1-5H
InChI key:InChIKey=RKFHCLHWWUXRGG-UHFFFAOYSA-N
SMILES:FC=1C2=C(C=CC1F)C=CN=C2
Synonyms:
  • 7,8-Difluoroisoquinoline
  • Isoquinoline, 7,8-difluoro-
  • Isoquinoline, 7,8-difluoro- (9CI)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.