
CAS 476-73-3
:1,2,3,4-Benzenetetracarboxylic acid
Description:
1,2,3,4-Benzenetetracarboxylic acid, also known as pyromellitic acid, is an aromatic dicarboxylic acid characterized by its four carboxylic acid groups attached to a benzene ring. This compound is typically a white crystalline solid at room temperature and is soluble in water, alcohols, and other polar solvents. It has a melting point that varies depending on purity and form, but it generally exhibits high thermal stability. Pyromellitic acid is used in various applications, including the production of polyimides, plasticizers, and as a precursor for certain dyes and pharmaceuticals. Its structure allows for the formation of complexation with metal ions, making it useful in coordination chemistry. Additionally, it can participate in various chemical reactions, such as esterification and amidation, due to the presence of multiple functional groups. Safety data indicates that it should be handled with care, as it can cause irritation to the skin and eyes. Overall, 1,2,3,4-Benzenetetracarboxylic acid is a versatile compound with significant industrial relevance.
Formula:C10H6O8
InChI:InChI=1S/C10H6O8/c11-7(12)3-1-2-4(8(13)14)6(10(17)18)5(3)9(15)16/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18)
InChI key:InChIKey=GCAIEATUVJFSMC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(O)=O)C(C(O)=O)=CC=C1C(O)=O
Synonyms:- Mellophanic acid
- 1,2,3,4-Benzenetetracarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.