
CAS 4761-09-5
:1,3-Dibutyl-2-imidazolidinone
Description:
1,3-Dibutyl-2-imidazolidinone is a cyclic organic compound characterized by its imidazolidinone structure, which features a five-membered ring containing two nitrogen atoms and a carbonyl group. This compound typically exhibits a colorless to pale yellow appearance and is known for its relatively high boiling point and moderate solubility in organic solvents. It is often utilized as a solvent or reagent in various chemical reactions, particularly in organic synthesis and materials science. The presence of butyl groups enhances its hydrophobic properties, making it suitable for applications in non-polar environments. Additionally, 1,3-Dibutyl-2-imidazolidinone may exhibit interesting chemical reactivity due to the functional groups present, allowing it to participate in nucleophilic and electrophilic reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound is valued for its unique structural features and versatility in chemical applications.
Formula:C11H22N2O
InChI:InChI=1S/C11H22N2O/c1-3-5-7-12-9-10-13(11(12)14)8-6-4-2/h3-10H2,1-2H3
InChI key:InChIKey=FXCPLDHPNOXGOM-UHFFFAOYSA-N
SMILES:C(CCC)N1C(=O)N(CCCC)CC1
Synonyms:- N,N′-Dibutylethyleneurea
- NSC 186243
- 1,3-Dibutyl-2-imidazolidinone
- 2-Imidazolidinone, 1,3-dibutyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.