CAS 476187-34-5

Methyl (2S,3R)-2-methyl-3-piperidinecarboxylate

Description:

Methyl (2S,3R)-2-methyl-3-piperidinecarboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a methyl group at the second carbon and a carboxylate functional group at the third carbon, contributing to its reactivity and potential applications in organic synthesis. The specific stereochemistry indicated by the (2S,3R) notation suggests that the compound has two chiral centers, which can influence its biological activity and interactions with other molecules. Methyl (2S,3R)-2-methyl-3-piperidinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, making it useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₈H₁₅NO₂

InChI: InChI=1S/C8H15NO2/c1-6-7(8(10)11-2)4-3-5-9-6/h6-7,9H,3-5H2,1-2H3/t6-,7+/m0/s1

InChI key: InChIKey=ZORUKIWYFWDAKK-NKWVEPMBSA-N

SMILES: C(OC)(=O)[C@H]1[C@H](C)NCCC1

Synonyms:

• Methyl (2S,3R)-2-methyl-3-piperidinecarboxylate
• 3-Piperidinecarboxylic acid, 2-methyl-, methyl ester, (2S,3R)-