CAS 476199-13-0
:4-methoxy-1-benzothiophene-2-carbonitrile
Description:
4-Methoxy-1-benzothiophene-2-carbonitrile is an organic compound characterized by its unique structure, which includes a benzothiophene core substituted with a methoxy group and a cyano group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the cyano group. The methoxy group can influence the electronic properties of the molecule, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of the thiophene ring contributes to its aromatic character and may impart specific electronic and optical properties, making it of interest in materials science and organic electronics. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where the thiophene moiety is often associated with biological activity. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the cyano group, which is known to be toxic.
Formula:C10H7NOS
InChI:InChI=1/C10H7NOS/c1-12-9-3-2-4-10-8(9)5-7(6-11)13-10/h2-5H,1H3
SMILES:COc1cccc2c1cc(C#N)s2
Synonyms:- 4-Methoxy-1-benzothiophen-2-carbonitril
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.