CAS 476199-30-1
:4-hydroxybenzothiophene-2-carbonitrile
Description:
4-Hydroxybenzothiophene-2-carbonitrile is an organic compound characterized by its unique structure, which includes a benzothiophene core with a hydroxyl group and a cyano group attached. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the cyano group. The hydroxyl group can participate in hydrogen bonding, influencing its solubility and reactivity in various solvents. Additionally, the presence of the thiophene ring contributes to its electronic properties, making it potentially useful in organic electronics or as a building block in the synthesis of more complex molecules. The compound may also exhibit biological activity, which is of interest in pharmaceutical research. Its specific applications and behavior can vary based on the conditions under which it is used, such as pH, temperature, and the presence of other chemical species. Overall, 4-hydroxybenzothiophene-2-carbonitrile is a versatile compound with potential applications in various fields of chemistry and materials science.
Formula:C9H5NOS
InChI:InChI=1/C9H5NOS/c10-5-6-4-7-8(11)2-1-3-9(7)12-6/h1-4,11H
SMILES:c1cc(c2cc(C#N)sc2c1)O
Synonyms:- 4-Hydroxy-1-benzothiophen-2-carbonitril
- 4-Hydroxy-1-Benzothiophene-2-Carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.