CAS 4762-17-8
:(E)-amino[(N'-tert-butylcarbamimidoyl)imino]methanaminium chloride
Description:
(E)-amino[(N'-tert-butylcarbamimidoyl)imino]methanaminium chloride, with the CAS number 4762-17-8, is a chemical compound characterized by its unique structural features. It contains an amino group and a carbamimidoyl moiety, which contribute to its potential as a biological or pharmaceutical agent. The presence of the tert-butyl group enhances its stability and solubility in organic solvents. This compound is typically encountered as a chloride salt, which influences its ionic properties and solubility in aqueous solutions. The (E)-configuration indicates a specific geometric arrangement around the double bond, which can affect its reactivity and interaction with biological targets. Its potential applications may include roles in medicinal chemistry, particularly in the development of inhibitors or modulators of biological pathways. As with many nitrogen-containing compounds, it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Overall, this compound's unique structure and properties make it of interest in both synthetic and medicinal chemistry.
Formula:C6H16ClN5
InChI:InChI=1/C6H15N5.ClH/c1-6(2,3)11-5(9)10-4(7)8;/h1-3H3,(H6,7,8,9,10,11);1H
SMILES:CC(C)(C)NC(=N)NC(=N)N.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.