CAS 476362-79-5

5-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]-3-thiophenecarboxylic acid

Description:

5-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]-3-thiophenecarboxylic acid, with CAS number 476362-79-5, is a chemical compound characterized by its complex structure, which includes a thiophene ring and a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically used in peptide synthesis and other organic synthesis applications due to its ability to protect amino groups during chemical reactions. The presence of the thiophene moiety contributes to its unique electronic properties and potential biological activity. The Fmoc group is particularly valuable in solid-phase peptide synthesis, allowing for selective deprotection under mild conditions. The compound is likely to exhibit moderate solubility in organic solvents and may have specific reactivity patterns due to the functional groups present. Its synthesis and handling require standard laboratory safety protocols, as with many organic compounds. Overall, this substance is significant in the field of medicinal chemistry and peptide research, where it can serve as an intermediate or building block for more complex molecules.

Formula: C₂₁H₁₇NO₄S

InChI: InChI=1S/C21H17NO4S/c23-20(24)13-9-14(27-12-13)10-22-21(25)26-11-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-9,12,19H,10-11H2,(H,22,25)(H,23,24)

InChI key: InChIKey=QBXNPZGCIYDPBK-UHFFFAOYSA-N

SMILES: C(OC(NCC1=CC(C(O)=O)=CS1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 5-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]-3-thiophenecarboxylic acid
• 3-Thiophenecarboxylic acid, 5-[[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]-