CAS 4764-13-0

2-(piperidin-1-ylmethyl)phenol

Description:

2-(Piperidin-1-ylmethyl)phenol, with the CAS number 4764-13-0, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of a piperidine ring, a six-membered nitrogen-containing heterocycle, contributes to its unique properties. This compound typically appears as a solid or liquid depending on the specific conditions, and it is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals. Its molecular structure allows for hydrogen bonding due to the hydroxyl group, which can influence its solubility and reactivity. Additionally, the piperidine moiety can enhance the compound's biological activity by interacting with various biological targets. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-(piperidin-1-ylmethyl)phenol is of interest in both research and industrial applications due to its functional groups and structural characteristics.

Formula: C₁₂H₁₇NO

InChI: InChI=1/C12H17NO/c14-12-7-3-2-6-11(12)10-13-8-4-1-5-9-13/h2-3,6-7,14H,1,4-5,8-10H2

SMILES: C1CCN(CC1)Cc1ccccc1O

Synonyms:

• Phenol, 2-(1-piperidinylmethyl)-
• 2-(Piperidin-1-ylmethyl)phenol

2-(Piperidin-1-ylmethyl)phenol

CAS: 4764-13-0

Formula: C₁₂H₁₇NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 191.2695

Ref: IN-DA00DATF

2-(Piperidin-1-ylmethyl)phenol

CAS: 4764-13-0

2-(Piperidin-1-ylmethyl)phenol

Purity: 95%

Molecular weight: 191.27g/mol

Ref: 54-OR1072534

2-(piperidin-1-ylmethyl)phenol

CAS: 4764-13-0

Formula: C₁₂H₁₇NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.274

Ref: 10-F309977