CAS 476493-48-8

1-Propanaminium, 2-hydroxy-N,N,N-trimethyl-3-phosphono-, inner salt, (2S)-

Description:

1-Propanaminium, 2-hydroxy-N,N,N-trimethyl-3-phosphono-, inner salt, also known by its CAS number 476493-48-8, is a quaternary ammonium compound characterized by its phosphono group and a hydroxyl functional group. This compound typically exhibits properties such as high solubility in water due to its ionic nature, which is a result of the quaternary ammonium structure. It is often used in various applications, including as a surfactant, in biochemical research, and potentially in drug formulation due to its ability to interact with biological membranes. The presence of the phosphono group suggests potential reactivity and interactions with other biomolecules, making it of interest in medicinal chemistry. Additionally, the inner salt formation indicates that it can exist in a stable ionic form, which may influence its biological activity and stability under different pH conditions. Overall, this compound's unique structure contributes to its diverse applications in both industrial and research settings.

Formula: C₆H₁₆NO₄P

InChI: InChI=1S/C6H16NO4P/c1-7(2,3)4-6(8)5-12(9,10)11/h6,8H,4-5H2,1-3H3,(H-,9,10,11)/t6-/m0/s1

InChI key: InChIKey=CFKIUJQHVVMWGR-LURJTMIESA-N

SMILES: C([N+](C)(C)C)[C@@H](CP(=O)([O-])O)O

Synonyms:

• 1-Propanaminium, 2-hydroxy-N,N,N-trimethyl-3-phosphono-, inner salt, (2S)-