CAS 4765-22-4

2-(1H-indol-3-yl)propan-1-amine

Description:

2-(1H-indol-3-yl)propan-1-amine, also known as tryptamine, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features a propan-1-amine side chain, which contributes to its basic amine properties. Tryptamine is a colorless to pale yellow solid at room temperature and is soluble in water and organic solvents, reflecting its polar nature due to the presence of the amine group. It is known for its role as a neurotransmitter and is a precursor to various biologically significant compounds, including serotonin and melatonin. Tryptamine exhibits various biological activities and has been studied for its potential effects on mood and cognition. Its chemical reactivity is influenced by the indole nitrogen, which can participate in hydrogen bonding and other interactions, making it a subject of interest in medicinal chemistry and pharmacology.

Formula: C₁₁H₁₄N₂

InChI: InChI=1/C11H14N2/c1-8(6-12)10-7-13-11-5-3-2-4-9(10)11/h2-5,7-8,13H,6,12H2,1H3

SMILES: CC(CN)c1c[nH]c2ccccc12

Synonyms:

• 1H-indole-3-ethanamine, beta-methyl-
• 2-methyl-1H-indole-3-ethylamine