
CAS 4765-25-7
:6-Ethyl-1H-indole-3-ethanamine
Description:
6-Ethyl-1H-indole-3-ethanamine, with the CAS number 4765-25-7, is an organic compound that belongs to the class of indole derivatives. Characterized by its indole core structure, it features an ethyl group at the 6-position and an ethylamine side chain at the 3-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential biological activity, which may include interactions with neurotransmitter systems, making it of interest in pharmacological research. The presence of both the indole and amine functional groups suggests that it may participate in hydrogen bonding and other intermolecular interactions, influencing its solubility and reactivity. Additionally, the compound's structure may allow for various synthetic modifications, which can lead to the development of derivatives with enhanced properties or activities. As with many organic compounds, safety and handling precautions should be observed, as its biological effects and toxicity profiles are not fully characterized.
Formula:C12H16N2
InChI:InChI=1S/C12H16N2/c1-2-9-3-4-11-10(5-6-13)8-14-12(11)7-9/h3-4,7-8,14H,2,5-6,13H2,1H3
InChI key:InChIKey=BDIDXHXHOZSHRX-UHFFFAOYSA-N
SMILES:C(CN)C=1C=2C(=CC(CC)=CC2)NC1
Synonyms:- 2-(6-Ethyl-1H-indol-3-yl)ethan-1-amine
- 1H-Indole-3-ethanamine, 6-ethyl-
- Indole, 3-(2-aminoethyl)-6-ethyl-
- 6-Ethyl-1H-indole-3-ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.