
CAS 4765-54-2
:2-Propyl-4(3H)-quinazolinone
Description:
2-Propyl-4(3H)-quinazolinone, with the CAS number 4765-54-2, is an organic compound belonging to the quinazolinone class, which is characterized by a fused bicyclic structure containing a benzene ring and a pyrimidine ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but may have limited solubility in water. Its molecular structure includes a propyl group at the 2-position and a carbonyl group at the 4-position of the quinazolinone ring, contributing to its unique chemical properties. 2-Propyl-4(3H)-quinazolinone has garnered interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and analgesic effects. Additionally, it may serve as a scaffold for the development of various pharmaceuticals. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-2-5-10-12-9-7-4-3-6-8(9)11(14)13-10/h3-4,6-7H,2,5H2,1H3,(H,12,13,14)
InChI key:InChIKey=MFAZKHYKVSPPIB-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(CCC)=N1)=CC=CC2
Synonyms:- 2-Propyl-4-quinazolinone
- NSC 155575
- 2-Propyl-4(3H)-quinazolinone
- 4(1H)-Quinazolinone, 2-propyl-
- 4(3H)-Quinazolinone, 2-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.