CAS 4765-63-3

1,4,6-triaminopyrimidine-2(1H)-thione

Description:

1,4,6-Triaminopyrimidine-2(1H)-thione, with the CAS number 4765-63-3, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is substituted with three amino groups and a thione functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, such as water and alcohols, due to the presence of the amino groups that can engage in hydrogen bonding. The thione group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its biological activity may include potential applications in pharmaceuticals, particularly in the development of antimicrobial or antitumor agents, owing to the structural features that can interact with biological targets. Additionally, the compound's stability and reactivity can be influenced by pH and temperature, making it important to consider these factors in practical applications. Overall, 1,4,6-triaminopyrimidine-2(1H)-thione is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₄H₇N₅S

InChI: InChI=1/C4H7N5S/c5-2-1-3(6)9(7)4(10)8-2/h1H,6-7H2,(H2,5,8,10)

SMILES: c1c(=N)nc(n(c1N)N)S

Synonyms:

• 2(1H)-pyrimidinethione, 1,4,6-triamino-
• 1,4,6-Triaminopyrimidine-2(1H)-thione

1,4,6-Triamino-1,2-dihydropyrimidine-2-thione

CAS: 4765-63-3

1,4,6-Triamino-1,2-dihydropyrimidine-2-thione is a chemical compound that is soluble in water and methanol. It has been shown to cleave bonds by the use of sodium hydroxide solution.

Formula: C₄H₇N₅S

Purity: Min. 95%

Molecular weight: 157.2 g/mol

Ref: 3D-EAA76563