CAS 476622-89-6

5-bromo-2-iodo-3-methoxypyrazine

Description:

5-Bromo-2-iodo-3-methoxypyrazine is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of bromine and iodine substituents at the 5 and 2 positions, respectively, contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methoxy group at the 3 position enhances its solubility and may influence its biological activity. This compound is typically synthesized through halogenation and methoxylation reactions, and its structure can be confirmed using techniques such as NMR and mass spectrometry. Due to the presence of halogens, it may exhibit interesting electronic properties and reactivity patterns, making it a subject of interest in synthetic organic chemistry. Additionally, its potential applications in flavor chemistry and as a building block in the synthesis of more complex molecules highlight its significance in both industrial and research settings. Safety and handling precautions should be observed due to the presence of halogenated compounds, which can pose health risks.

Formula: C₅H₄BrIN₂O

InChI: InChI=1/C5H4BrIN2O/c1-10-5-4(7)8-2-3(6)9-5/h2H,1H3

SMILES: COc1c(I)ncc(Br)n1

Synonyms:

• Pyrazine, 5-Bromo-2-Iodo-3-Methoxy-
• 5-Bromo-2-iodo-3-methoxypyrazine

5-Bromo-2-iodo-3-methoxypyrazine

CAS: 476622-89-6

Formula: C₅H₄BrIN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 314.9065

Ref: IN-DA006ZR1

5-Bromo-2-iodo-3-methoxypyrazine

CAS: 476622-89-6

5-Bromo-2-iodo-3-methoxypyrazine

Purity: 98%

Molecular weight: 314.91g/mol

Ref: 54-OR471728

5-Bromo-2-iodo-3-methoxypyrazine

CAS: 476622-89-6

Formula: C₅H₄BrIN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 314.908

Ref: 10-F214680