CAS 476646-93-2

3-acetyl-4,4,5,5-tetradeuterio-tetrahydrofuran-2-one

Description:

3-Acetyl-4,4,5,5-tetradeuterio-tetrahydrofuran-2-one is a deuterated derivative of tetrahydrofuran-2-one, which is a cyclic lactone. The presence of deuterium, a stable isotope of hydrogen, in the molecular structure enhances its utility in various analytical applications, particularly in NMR spectroscopy, where it can provide clearer spectral data due to reduced overlap with hydrogen signals. This compound features a tetrahydrofuran ring, which contributes to its cyclic structure and stability. The acetyl group introduces a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic additions. The deuteration can also influence the compound's physical properties, such as boiling point and solubility, compared to its non-deuterated counterparts. Overall, this compound is of interest in synthetic organic chemistry and may be utilized in studies involving reaction mechanisms or as a tracer in metabolic studies. Its specific applications and behavior would depend on the context of its use in research or industrial processes.

Formula: C₆H₄D₄O₃

InChI: InChI=1/C6H8O3/c1-4(7)5-2-3-9-6(5)8/h5H,2-3H2,1H3/i2D2,3D2

SMILES: CC(=O)C1C(C(OC1=O)([2H])[2H])([2H])[2H]