CAS 4767-32-2

{[(2,5-dichloroanilino)(imino)methyl]amino}methanimidamide hydrochloride

Description:

{[(2,5-dichloroanilino)(imino)methyl]amino}methanimidamide hydrochloride, with the CAS number 4767-32-2, is a chemical compound characterized by its complex structure, which includes a dichloroaniline moiety and an imino group. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in pharmaceutical and biochemical research. The presence of the dichloro substituents suggests potential biological activity, as halogenated compounds often exhibit unique interactions with biological targets. The imino and amino functional groups indicate that this compound may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the hydrochloride form implies that it is likely to be stable under standard laboratory conditions, making it a useful candidate for further studies in medicinal chemistry or as a potential therapeutic agent. Overall, its unique structural features contribute to its potential utility in various chemical and biological applications.

Formula: C₈H₁₀Cl₃N₅

InChI: InChI=1/C8H9Cl2N5.ClH/c9-4-1-2-5(10)6(3-4)14-8(13)15-7(11)12;/h1-3H,(H6,11,12,13,14,15);1H

SMILES: c1cc(c(cc1Cl)NC(=N)NC(=N)N)Cl.Cl

Synonyms:

• 1-(Diaminomethylidene)-2-(2,5-Dichlorophenyl)Guanidine Hydrochloride

1-(2,5-Dichlorophenyl)biguanide hydrochloride

CAS: 4767-32-2

1-(2,5-Dichlorophenyl)biguanide hydrochloride

Purity: ≥95%

Molecular weight: 282.56g/mol

Ref: 54-OR7819