CAS 477-20-3
:Homolycorine
Description:
Homolycorine is a chemical compound classified as an alkaloid, primarily derived from plants in the Amaryllidaceae family. It is known for its structural complexity, featuring a bicyclic framework that includes a phenanthridine core. This compound exhibits notable biological activities, including potential antitumor and antimicrobial properties, making it of interest in pharmacological research. Homolycorine is typically found in various plant species, particularly those with medicinal uses. Its chemical properties include solubility in organic solvents, and it may exhibit varying degrees of stability depending on environmental conditions such as pH and temperature. The compound's interactions with biological systems are an area of ongoing study, as researchers explore its mechanisms of action and potential therapeutic applications. As with many alkaloids, caution is advised due to possible toxicity at certain concentrations. Overall, homolycorine represents a fascinating subject within the field of natural products chemistry and pharmacognosy.
Formula:C18H21NO4
InChI:InChI=1S/C18H21NO4/c1-19-7-6-10-4-5-13-16(17(10)19)11-8-14(21-2)15(22-3)9-12(11)18(20)23-13/h4,8-9,13,16-17H,5-7H2,1-3H3/t13-,16-,17-/m1/s1
InChI key:InChIKey=WXZAKVLYZHWSNF-KBRIMQKVSA-N
SMILES:CN1[C@]2([C@@]3(C=4C(=CC(OC)=C(OC)C4)C(=O)O[C@@]3(CC=C2CC1)[H])[H])[H]
Synonyms:- (+)-Homolycorine
- (5aR,11bS,11cS)-2,3,5,5a,11b,11c-Hexahydro-9,10-dimethoxy-1-methyl[2]benzopyrano[3,4-g]indol-7(1H)-one
- Homolycorin
- Lycorenan-7-one, 9,10-dimethoxy-1-methyl-
- Narcipoetine
- [2]Benzopyrano[3,4-g]indol-7(1H)-one, 2,3,5,5a,11b,11c-hexahydro-9,10-dimethoxy-1-methyl-, [5aR-(5aα,11bα,11cβ)]-
- [2]benzopyrano[3,4-g]indol-7(1H)-one, 2,3,5,5a,11b,11c-hexahydro-9,10-dimethoxy-1-methyl-, (5aR,11bS,11cS)-
- 9,10-Dimethoxy-1-methyllycorenan-7-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
