
CAS 477-52-1
:(5R)-5,9-Dihydro-5-(3,4,5-trimethoxyphenyl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one
Description:
(5R)-5,9-Dihydro-5-(3,4,5-trimethoxyphenyl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one, with CAS number 477-52-1, is a complex organic compound characterized by its unique fused ring structure that incorporates both furan and naphthalene moieties. This compound features multiple methoxy groups, which enhance its solubility and may influence its biological activity. The presence of the dioxole ring contributes to its stability and reactivity, making it of interest in various chemical and pharmaceutical applications. Its stereochemistry, indicated by the (5R) designation, suggests specific spatial arrangements that can affect its interaction with biological targets. Such compounds are often studied for their potential therapeutic properties, including anti-inflammatory and anticancer activities. The intricate structure and functional groups present in this molecule make it a subject of interest in medicinal chemistry and organic synthesis, where understanding its properties can lead to the development of novel drugs or materials.
Formula:C22H20O7
InChI:InChI=1S/C22H20O7/c1-24-17-6-12(7-18(25-2)21(17)26-3)19-14-8-16-15(28-10-29-16)5-11(14)4-13-9-27-22(23)20(13)19/h5-8,19H,4,9-10H2,1-3H3/t19-/m1/s1
InChI key:InChIKey=OPGVEBTYBAOEHZ-LJQANCHMSA-N
SMILES:O=C1C=2[C@@H](C=3C(CC2CO1)=CC4=C(C3)OCO4)C5=CC(OC)=C(OC)C(OC)=C5
Synonyms:- β-Apopicropodophyllin
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one, 5,9-dihydro-5-(3,4,5-trimethoxyphenyl)-, (5R)-
- (5R)-5,9-Dihydro-5-(3,4,5-trimethoxyphenyl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one, 5,9-dihydro-5-(3,4,5-trimethoxyphenyl)-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
β-Apopicropodophyllin
CAS:<p>β-Apopicropodophyllin, a natural product isolated from Hyptis wticillata, promotes apoptosis through mechanisms including microtubule disruption, DNA damage,</p>Formula:C22H20O7Color and Shape:SolidMolecular weight:396.39β-Apopicropodophyllin
CAS:Controlled ProductFormula:C22H20O7Color and Shape:NeatMolecular weight:396.39β-Apopicropodophyllin
CAS:Controlled ProductFormula:C22H20O7Color and Shape:NeatMolecular weight:396.39

