CAS 477-89-4
:6-Methoxy-9-methyl-1,3-dioxolo[4,5-h]quinolin-8(9H)-one
Description:
6-Methoxy-9-methyl-1,3-dioxolo[4,5-h]quinolin-8(9H)-one, with the CAS number 477-89-4, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline core structure, which is characterized by a bicyclic aromatic system containing a nitrogen atom. The presence of a methoxy group at the 6-position and a methyl group at the 9-position contributes to its unique chemical properties and potential biological activities. The dioxole moiety in its structure indicates the presence of a five-membered ring containing two oxygen atoms, which can influence the compound's reactivity and solubility. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and biological activities would depend on further research and characterization. As with many organic compounds, it is essential to handle it with care, following appropriate safety protocols due to potential toxicity or reactivity.
Formula:C12H11NO4
InChI:InChI=1/C12H11NO4/c1-13-10(14)5-9(15-2)7-3-4-8-12(11(7)13)17-6-16-8/h3-5H,6H2,1-2H3
InChI key:InChIKey=DPXXJCMMMXZVSW-UHFFFAOYSA-N
SMILES:CN1C2=C(C(OC)=CC1=O)C=CC3=C2OCO3
Synonyms:- 1,3-Dioxolo[4,5-h]quinolin-8(9H)-one, 6-methoxy-9-methyl-
- 6-Methoxy-9-methyl-1,3-dioxolo[4,5-h]quinolin-8(9H)-one
- Casimiroine
- casimiroin
- 6-methoxy-9-methyl[1,3]dioxolo[4,5-h]quinolin-8(9H)-one
- Casimiroin
- 6-Methoxy-9-methyl-9H-[1,3]dioxolo[4,5-h]quinolin-8-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Casimiroin
CAS:Casimiroin is a quinone reductase 2 inhibitor; isolated from Casimiroa edulis.Formula:C12H11NO4Color and Shape:SolidMolecular weight:233.22
