CAS 4770-74-5
:2-(4-nitrophenyl)-2,3-dihydro-1H-isoindol-1-one
Description:
2-(4-Nitrophenyl)-2,3-dihydro-1H-isoindol-1-one, with the CAS number 4770-74-5, is an organic compound characterized by its isoindole structure, which features a bicyclic framework. This compound contains a nitrophenyl group, contributing to its potential reactivity and applications in various chemical processes. It typically appears as a solid at room temperature and may exhibit yellow to orange coloration due to the presence of the nitro group, which can influence its electronic properties. The presence of the nitro group also suggests that the compound may participate in electrophilic aromatic substitution reactions. Additionally, the dihydroisoindole moiety can exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility can vary depending on the solvent, and it may show varying degrees of stability under different conditions. Overall, this compound's unique structure and functional groups make it a valuable candidate for further research in organic synthesis and pharmacology.
Formula:C14H10N2O3
InChI:InChI=1/C14H10N2O3/c17-14-13-4-2-1-3-10(13)9-15(14)11-5-7-12(8-6-11)16(18)19/h1-8H,9H2
SMILES:c1ccc2c(c1)CN(c1ccc(cc1)N(=O)=O)C2=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.