CAS 477207-33-3

3-(Bromomethyl)-2-chloro-6-(trifluoromethyl)pyridine

Description:

3-(Bromomethyl)-2-chloro-6-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromomethyl group at the 3-position and a chloro substituent at the 2-position introduces significant reactivity, making it useful in various chemical syntheses. The trifluoromethyl group at the 6-position enhances the compound's lipophilicity and can influence its biological activity, often imparting unique properties such as increased metabolic stability and altered pharmacokinetics. This compound is typically a solid at room temperature and may exhibit moderate to high solubility in organic solvents. Its reactivity can be attributed to the electrophilic nature of the bromomethyl and chloro groups, making it a potential candidate for nucleophilic substitution reactions. Additionally, the trifluoromethyl group can affect the electronic properties of the molecule, influencing its interactions in biological systems or materials science applications. Overall, this compound is of interest in medicinal chemistry and agrochemical research due to its diverse functional groups and potential applications.

Formula: C₇H₄BrClF₃N

InChI: InChI=1S/C7H4BrClF3N/c8-3-4-1-2-5(7(10,11)12)13-6(4)9/h1-2H,3H2

InChI key: InChIKey=GEASZNBTMLEEGX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N=C(Cl)C(CBr)=CC1

Synonyms:

• 3-Bromomethyl-2-chloro-6-trifluoromethylpyridine
• Pyridine, 3-(bromomethyl)-2-chloro-6-(trifluoromethyl)-
• 3-(Bromomethyl)-2-chloro-6-(trifluoromethyl)pyridine