CAS 477250-52-5

β-Amino-1H-indole-5-propanoic acid

Description:

β-Amino-1H-indole-5-propanoic acid, identified by its CAS number 477250-52-5, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an amino group and a propanoic acid moiety, contributing to its potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which is common for amino acids and their derivatives. The presence of the amino group suggests that it may participate in various biochemical reactions, including those involving protein synthesis or neurotransmitter activity. Its structural features may also indicate potential applications in pharmaceuticals, particularly in the development of compounds targeting neurological or metabolic pathways. As with many indole derivatives, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific properties such as melting point, boiling point, and solubility can vary and should be referenced from reliable chemical databases or literature for precise applications.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1S/C11H12N2O2/c12-9(6-11(14)15)7-1-2-10-8(5-7)3-4-13-10/h1-5,9,13H,6,12H2,(H,14,15)

InChI key: InChIKey=SOJSEYFXCRVKPU-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(N)C=1C=C2C(=CC1)NC=C2

Synonyms:

• β-Amino-1H-indole-5-propanoic acid
• 1H-Indole-5-propanoic acid, β-amino-
• 3-Amino-3-(1H-indol-5-yl)propanoic acid