
CAS 477319-13-4
:3-[(3,4-Dimethylphenyl)amino]-1-(4-methylphenyl)-1-propanone
Description:
3-[(3,4-Dimethylphenyl)amino]-1-(4-methylphenyl)-1-propanone, identified by its CAS number 477319-13-4, is an organic compound characterized by its complex structure featuring an amine group and a ketone functional group. This substance typically appears as a solid or crystalline material and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. The presence of multiple aromatic rings contributes to its stability and may influence its reactivity and solubility in different solvents. The dimethyl and methyl substituents on the phenyl rings can affect the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, this compound may exhibit specific biological activities, making it of interest in pharmaceutical research. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with safety regulations.
Formula:C18H21NO
InChI:InChI=1S/C18H21NO/c1-13-4-7-16(8-5-13)18(20)10-11-19-17-9-6-14(2)15(3)12-17/h4-9,12,19H,10-11H2,1-3H3
InChI key:InChIKey=OATZBCJRZYTJNB-UHFFFAOYSA-N
SMILES:N(CCC(=O)C1=CC=C(C)C=C1)C2=CC(C)=C(C)C=C2
Synonyms:- 3-[(3,4-Dimethylphenyl)amino]-1-(4-methylphenyl)-1-propanone
- 1-Propanone, 3-[(3,4-dimethylphenyl)amino]-1-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.