
CAS 477319-99-6
:3-[(4-Ethoxyphenyl)amino]-1-(4-methoxyphenyl)-1-propanone
Description:
3-[(4-Ethoxyphenyl)amino]-1-(4-methoxyphenyl)-1-propanone, identified by its CAS number 477319-99-6, is an organic compound characterized by its complex structure, which includes an amine group and two aromatic rings. This compound typically exhibits properties associated with both ketones and amines, such as potential reactivity in nucleophilic substitution reactions. The presence of ethoxy and methoxy substituents on the phenyl rings can influence its solubility, polarity, and overall chemical behavior, making it more soluble in organic solvents. Additionally, the compound may exhibit biological activity, which is often explored in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The stability of the compound can be affected by environmental factors such as temperature and pH, and it may undergo various chemical reactions, including oxidation or reduction, depending on the conditions. Overall, this compound represents a class of organic molecules with diverse applications in chemical synthesis and drug development.
Formula:C18H21NO3
InChI:InChI=1S/C18H21NO3/c1-3-22-17-10-6-15(7-11-17)19-13-12-18(20)14-4-8-16(21-2)9-5-14/h4-11,19H,3,12-13H2,1-2H3
InChI key:InChIKey=QZJMRTVNHRZYOA-UHFFFAOYSA-N
SMILES:C(CCNC1=CC=C(OCC)C=C1)(=O)C2=CC=C(OC)C=C2
Synonyms:- 3-[(4-Ethoxyphenyl)amino]-1-(4-methoxyphenyl)-1-propanone
- 1-Propanone, 3-[(4-ethoxyphenyl)amino]-1-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.