
CAS 477320-08-4
:1-[1,1′-Biphenyl]-4-yl-3-[(2,3,4,5,6-pentafluorophenyl)thio]-1-propanone
Description:
1-[1,1′-Biphenyl]-4-yl-3-[(2,3,4,5,6-pentafluorophenyl)thio]-1-propanone, with CAS number 477320-08-4, is an organic compound characterized by its complex structure featuring a biphenyl moiety and a thioether linkage to a highly fluorinated phenyl group. This compound typically exhibits properties associated with both aromatic and fluorinated compounds, such as increased stability and lipophilicity due to the presence of multiple fluorine atoms. The thioether functional group can influence its reactivity and solubility in various solvents. Additionally, the presence of the ketone functional group suggests potential reactivity in nucleophilic addition reactions. The compound may be of interest in materials science, pharmaceuticals, or organic synthesis due to its unique electronic properties and potential applications in developing advanced materials or as a building block in complex organic molecules. Its fluorinated nature may also impart specific characteristics such as increased resistance to degradation and enhanced thermal stability.
Formula:C21H13F5OS
InChI:InChI=1S/C21H13F5OS/c22-16-17(23)19(25)21(20(26)18(16)24)28-11-10-15(27)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2
InChI key:InChIKey=MXUHXOGFVJDWPU-UHFFFAOYSA-N
SMILES:S(CCC(=O)C1=CC=C(C=C1)C2=CC=CC=C2)C3=C(F)C(F)=C(F)C(F)=C3F
Synonyms:- 1-Propanone, 1-[1,1′-biphenyl]-4-yl-3-[(2,3,4,5,6-pentafluorophenyl)thio]-
- 1-Propanone, 1-[1,1′-biphenyl]-4-yl-3-[(pentafluorophenyl)thio]-
- 1-[1,1′-Biphenyl]-4-yl-3-[(2,3,4,5,6-pentafluorophenyl)thio]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.