
CAS 477320-15-3
:N-(2,4-Difluorophenyl)-4-(2-pyridinyl)-1-piperazineacetamide
Description:
N-(2,4-Difluorophenyl)-4-(2-pyridinyl)-1-piperazineacetamide, with the CAS number 477320-15-3, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered ring containing two nitrogen atoms, contributing to its pharmacological properties. The presence of a 2,4-difluorophenyl group and a pyridine moiety enhances its potential for biological activity, making it of interest in medicinal chemistry. The compound is typically characterized by its molecular structure, which includes functional groups that may influence its solubility, stability, and interaction with biological targets. It may exhibit properties such as moderate to high lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the specific arrangement of fluorine atoms and the pyridine ring can impart unique electronic characteristics, potentially influencing its reactivity and binding affinity to various receptors or enzymes. Overall, this compound is a subject of research for its potential therapeutic applications.
Formula:C17H18F2N4O
InChI:InChI=1S/C17H18F2N4O/c18-13-4-5-15(14(19)11-13)21-17(24)12-22-7-9-23(10-8-22)16-3-1-2-6-20-16/h1-6,11H,7-10,12H2,(H,21,24)
InChI key:InChIKey=HXWMJCVKQZTZNF-UHFFFAOYSA-N
SMILES:C(C(NC1=C(F)C=C(F)C=C1)=O)N2CCN(CC2)C3=CC=CC=N3
Synonyms:- 1-Piperazineacetamide, N-(2,4-difluorophenyl)-4-(2-pyridinyl)-
- N-(2,4-Difluorophenyl)-4-(2-pyridinyl)-1-piperazineacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.