
CAS 477320-29-9
:6-(4-Fluorophenyl)-1,2-dihydro-4-methyl-2-oxo-3-pyridinecarbonitrile
Description:
6-(4-Fluorophenyl)-1,2-dihydro-4-methyl-2-oxo-3-pyridinecarbonitrile, with the CAS number 477320-29-9, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a fluorophenyl group, indicating the presence of a fluorine atom on a phenyl ring, which can influence its electronic properties and reactivity. The presence of a carbonitrile functional group (-C≡N) suggests potential for nucleophilic reactivity, while the keto group (C=O) contributes to its overall stability and may participate in hydrogen bonding. The dihydropyridine structure indicates that it is partially saturated, which can affect its physical properties such as solubility and boiling point. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, including melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C13H9FN2O
InChI:InChI=1S/C13H9FN2O/c1-8-6-12(16-13(17)11(8)7-15)9-2-4-10(14)5-3-9/h2-6H,1H3,(H,16,17)
InChI key:InChIKey=IXTCNJCPCQHFLF-UHFFFAOYSA-N
SMILES:CC=1C=C(NC(=O)C1C#N)C2=CC=C(F)C=C2
Synonyms:- 3-Pyridinecarbonitrile, 6-(4-fluorophenyl)-1,2-dihydro-4-methyl-2-oxo-
- 6-(4-Fluorophenyl)-1,2-dihydro-4-methyl-2-oxo-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.