CAS 477320-49-3
:3-[(4-Fluorophenyl)amino]-1-(4-methylphenyl)-1-propanone
Description:
3-[(4-Fluorophenyl)amino]-1-(4-methylphenyl)-1-propanone, identified by its CAS number 477320-49-3, is an organic compound characterized by its unique molecular structure, which includes a propanone backbone substituted with both a fluorophenyl and a methylphenyl group. This compound typically exhibits properties associated with aromatic amines and ketones, such as moderate to high solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and affecting its interaction with biological systems. Additionally, the presence of the methyl group on the other phenyl ring may contribute to steric effects, influencing the compound's overall stability and reactivity. Such compounds may be of interest in medicinal chemistry and material science due to their potential applications in drug development and synthesis of novel materials. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C16H16FNO
InChI:InChI=1S/C16H16FNO/c1-12-2-4-13(5-3-12)16(19)10-11-18-15-8-6-14(17)7-9-15/h2-9,18H,10-11H2,1H3
InChI key:InChIKey=GKGVHGSYMISIIQ-UHFFFAOYSA-N
SMILES:C(CCNC1=CC=C(F)C=C1)(=O)C2=CC=C(C)C=C2
Synonyms:- 3-[(4-Fluorophenyl)amino]-1-(4-methylphenyl)-1-propanone
- 1-Propanone, 3-[(4-fluorophenyl)amino]-1-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.