CymitQuimica logo

CAS 477320-59-5

:

1-(4-Bromophenyl)-3-[(5-chloro-2-methoxyphenyl)amino]-1-propanone

Description:
1-(4-Bromophenyl)-3-[(5-chloro-2-methoxyphenyl)amino]-1-propanone, with the CAS number 477320-59-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a bromophenyl group and a chloro-methoxyphenyl amine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic components. The presence of halogen substituents (bromine and chlorine) can influence its electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, the methoxy group may affect its polarity and solubility. This compound may be of interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of new therapeutic agents. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C16H15BrClNO2
InChI:InChI=1S/C16H15BrClNO2/c1-21-16-7-6-13(18)10-14(16)19-9-8-15(20)11-2-4-12(17)5-3-11/h2-7,10,19H,8-9H2,1H3
InChI key:InChIKey=UAOZJPRJHQDPMB-UHFFFAOYSA-N
SMILES:N(CCC(=O)C1=CC=C(Br)C=C1)C2=C(OC)C=CC(Cl)=C2
Synonyms:
  • 1-(4-Bromophenyl)-3-[(5-chloro-2-methoxyphenyl)amino]-1-propanone
  • 1-Propanone, 1-(4-bromophenyl)-3-[(5-chloro-2-methoxyphenyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.