CymitQuimica logo

CAS 477320-60-8

:

3-[(5-Chloro-2-methoxyphenyl)amino]-1-(4-chlorophenyl)-1-propanone

Description:
3-[(5-Chloro-2-methoxyphenyl)amino]-1-(4-chlorophenyl)-1-propanone, identified by its CAS number 477320-60-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a propanone backbone substituted with both chloro and methoxy groups. This compound features an amine linkage, connecting a 5-chloro-2-methoxyphenyl group to a 4-chlorophenyl group, contributing to its potential biological activity. The presence of halogen atoms (chlorine) and a methoxy group suggests that it may exhibit unique electronic properties, influencing its reactivity and interactions with biological targets. Typically, such compounds are of interest in medicinal chemistry for their potential pharmacological applications, including anti-cancer or anti-inflammatory properties. The specific arrangement of functional groups can affect solubility, stability, and overall bioactivity. As with many synthetic compounds, safety and handling precautions are essential, given the potential toxicity associated with halogenated organic substances. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C16H15Cl2NO2
InChI:InChI=1S/C16H15Cl2NO2/c1-21-16-7-6-13(18)10-14(16)19-9-8-15(20)11-2-4-12(17)5-3-11/h2-7,10,19H,8-9H2,1H3
InChI key:InChIKey=HZWKVSXNWVZPGW-UHFFFAOYSA-N
SMILES:N(CCC(=O)C1=CC=C(Cl)C=C1)C2=C(OC)C=CC(Cl)=C2
Synonyms:
  • 1-Propanone, 3-[(5-chloro-2-methoxyphenyl)amino]-1-(4-chlorophenyl)-
  • 3-[(5-Chloro-2-methoxyphenyl)amino]-1-(4-chlorophenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.