
CAS 477320-62-0
:1-(3,4-Dichlorophenyl)-3-[(4-phenoxyphenyl)amino]-1-propanone
Description:
1-(3,4-Dichlorophenyl)-3-[(4-phenoxyphenyl)amino]-1-propanone, identified by its CAS number 477320-62-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a dichlorophenyl group and a phenoxyphenylamino moiety. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the amine and ketone functionalities. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its aromatic nature. The dichlorophenyl group may impart specific electronic properties, influencing its reactivity and interactions in biological systems. Additionally, the compound may be of interest in pharmaceutical research, particularly in the development of therapeutic agents, due to its structural features that could interact with biological targets. Safety and handling precautions should be observed, as with many synthetic organic compounds, due to potential toxicity or environmental impact.
Formula:C21H17Cl2NO2
InChI:InChI=1S/C21H17Cl2NO2/c22-19-11-6-15(14-20(19)23)21(25)12-13-24-16-7-9-18(10-8-16)26-17-4-2-1-3-5-17/h1-11,14,24H,12-13H2
InChI key:InChIKey=BMUZEHITTRVDTE-UHFFFAOYSA-N
SMILES:C(CCNC1=CC=C(OC2=CC=CC=C2)C=C1)(=O)C3=CC(Cl)=C(Cl)C=C3
Synonyms:- 1-(3,4-Dichlorophenyl)-3-[(4-phenoxyphenyl)amino]-1-propanone
- 1-Propanone, 1-(3,4-dichlorophenyl)-3-[(4-phenoxyphenyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.