CymitQuimica logo

CAS 477320-66-4

:

1-(4-Chlorophenyl)-3-[(2,3,4,5,6-pentafluorophenyl)thio]-1-propanone

Description:
1-(4-Chlorophenyl)-3-[(2,3,4,5,6-pentafluorophenyl)thio]-1-propanone, with the CAS number 477320-66-4, is an organic compound characterized by its complex structure featuring both chlorinated and fluorinated aromatic groups. This compound contains a propanone functional group, which is indicative of ketones, and a thioether linkage that connects the two aromatic rings. The presence of multiple fluorine atoms in the pentafluorophenyl moiety significantly influences its chemical properties, including increased electronegativity and potential for enhanced reactivity. The chlorophenyl group adds to the compound's overall hydrophobic character, which may affect its solubility in various solvents. Additionally, the presence of these halogen substituents can impact the compound's biological activity, making it of interest in pharmaceutical and agrochemical research. Overall, this compound's unique combination of functional groups and substituents contributes to its potential applications in various fields, including materials science and medicinal chemistry.
Formula:C15H8ClF5OS
InChI:InChI=1S/C15H8ClF5OS/c16-8-3-1-7(2-4-8)9(22)5-6-23-15-13(20)11(18)10(17)12(19)14(15)21/h1-4H,5-6H2
InChI key:InChIKey=MYZOEAHOCKEPJI-UHFFFAOYSA-N
SMILES:S(CCC(=O)C1=CC=C(Cl)C=C1)C2=C(F)C(F)=C(F)C(F)=C2F
Synonyms:
  • 1-(4-Chlorophenyl)-3-[(2,3,4,5,6-pentafluorophenyl)thio]-1-propanone
  • 1-Propanone, 1-(4-chlorophenyl)-3-[(pentafluorophenyl)thio]-
  • 1-Propanone, 1-(4-chlorophenyl)-3-[(2,3,4,5,6-pentafluorophenyl)thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.