CymitQuimica logo

CAS 477328-86-2

:

3-[4-(4-Nitrophenyl)-1-piperazinyl]-1-(2-thienyl)-1-propanone

Description:
3-[4-(4-Nitrophenyl)-1-piperazinyl]-1-(2-thienyl)-1-propanone, with the CAS number 477328-86-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a piperazine ring, a thienyl group, and a nitrophenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and pharmacology. The presence of the nitro group suggests it may participate in electrophilic reactions, while the piperazine ring can influence its pharmacokinetic properties, such as receptor binding and metabolic stability. Additionally, the thienyl group may contribute to its lipophilicity and overall molecular interactions. As with many compounds containing heterocycles and functional groups, it may exhibit specific biological activities, which could be explored in drug development or therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C17H19N3O3S
InChI:InChI=1S/C17H19N3O3S/c21-16(17-2-1-13-24-17)7-8-18-9-11-19(12-10-18)14-3-5-15(6-4-14)20(22)23/h1-6,13H,7-12H2
InChI key:InChIKey=FDDLMBKEDYPNER-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=CS1)N2CCN(CC2)C3=CC=C(N(=O)=O)C=C3
Synonyms:
  • 1-Propanone, 3-[4-(4-nitrophenyl)-1-piperazinyl]-1-(2-thienyl)-
  • 3-[4-(4-Nitrophenyl)-1-piperazinyl]-1-(2-thienyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.