
CAS 477328-93-1
:3-[(5-Chloro-2-methoxyphenyl)amino]-1-(4-methoxyphenyl)-1-propanone
Description:
3-[(5-Chloro-2-methoxyphenyl)amino]-1-(4-methoxyphenyl)-1-propanone, identified by its CAS number 477328-93-1, is an organic compound characterized by its complex molecular structure, which includes a propanone backbone substituted with both chloro and methoxy groups. This compound features an amine functional group, which contributes to its potential reactivity and biological activity. The presence of the chloro and methoxy substituents on the aromatic rings can influence its solubility, stability, and interaction with biological targets. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential anti-cancer or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. The compound's molecular weight, melting point, and solubility characteristics would be essential for practical applications, including formulation in pharmaceuticals. As with many organic compounds, safety data and handling precautions are crucial, particularly due to the presence of chlorine, which can pose environmental and health risks.
Formula:C17H18ClNO3
InChI:InChI=1S/C17H18ClNO3/c1-21-14-6-3-12(4-7-14)16(20)9-10-19-15-11-13(18)5-8-17(15)22-2/h3-8,11,19H,9-10H2,1-2H3
InChI key:InChIKey=FTRGLRFWRQYUBT-UHFFFAOYSA-N
SMILES:N(CCC(=O)C1=CC=C(OC)C=C1)C2=C(OC)C=CC(Cl)=C2
Synonyms:- 1-Propanone, 3-[(5-chloro-2-methoxyphenyl)amino]-1-(4-methoxyphenyl)-
- 3-[(5-Chloro-2-methoxyphenyl)amino]-1-(4-methoxyphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.