
CAS 477328-96-4
:3-[(5-Chloro-2-methoxyphenyl)amino]-1-(2-naphthalenyl)-1-propanone
Description:
3-[(5-Chloro-2-methoxyphenyl)amino]-1-(2-naphthalenyl)-1-propanone, identified by its CAS number 477328-96-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a propanone backbone substituted with both a chloro and a methoxy group on a phenyl ring, as well as a naphthyl group. This compound typically exhibits properties associated with aromatic amines, such as potential biological activity and solubility in organic solvents. The presence of the chloro and methoxy substituents can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound may exhibit specific pharmacological properties, which would require further investigation through biological assays to determine its efficacy and safety profile. Overall, this compound represents a class of molecules that could have applications in drug development or as intermediates in organic synthesis.
Formula:C20H18ClNO2
InChI:InChI=1S/C20H18ClNO2/c1-24-20-9-8-17(21)13-18(20)22-11-10-19(23)16-7-6-14-4-2-3-5-15(14)12-16/h2-9,12-13,22H,10-11H2,1H3
InChI key:InChIKey=PAEQIWLEEGCNHL-UHFFFAOYSA-N
SMILES:C(CCNC1=C(OC)C=CC(Cl)=C1)(=O)C2=CC3=C(C=C2)C=CC=C3
Synonyms:- 3-[(5-Chloro-2-methoxyphenyl)amino]-1-(2-naphthalenyl)-1-propanone
- 1-Propanone, 3-[(5-chloro-2-methoxyphenyl)amino]-1-(2-naphthalenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.