
CAS 477333-84-9
:3-[(4-Methoxyphenyl)amino]-1-(2-naphthalenyl)-1-propanone
Description:
3-[(4-Methoxyphenyl)amino]-1-(2-naphthalenyl)-1-propanone, identified by its CAS number 477333-84-9, is an organic compound characterized by its complex structure that includes a propanone moiety linked to an amino group and aromatic rings. This compound features a methoxy-substituted phenyl group and a naphthyl group, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the methoxy group enhances its lipophilicity and may influence its biological activity. The compound is likely to exhibit properties typical of ketones, such as reactivity in nucleophilic addition reactions, and may also participate in hydrogen bonding due to the amino group. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. However, detailed studies on its pharmacokinetics, toxicity, and specific applications would be necessary to fully understand its utility in various fields.
Formula:C20H19NO2
InChI:InChI=1S/C20H19NO2/c1-23-19-10-8-18(9-11-19)21-13-12-20(22)17-7-6-15-4-2-3-5-16(15)14-17/h2-11,14,21H,12-13H2,1H3
InChI key:InChIKey=VJOXCONJBHSZNU-UHFFFAOYSA-N
SMILES:C(CCNC1=CC=C(OC)C=C1)(=O)C2=CC3=C(C=C2)C=CC=C3
Synonyms:- 3-[(4-Methoxyphenyl)amino]-1-(2-naphthalenyl)-1-propanone
- 1-Propanone, 3-[(4-methoxyphenyl)amino]-1-(2-naphthalenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.