CymitQuimica logo

CAS 477333-86-1

:

3-(1,3-Benzodioxol-5-ylamino)-1-[1,1′-biphenyl]-4-yl-1-propanone

Description:
3-(1,3-Benzodioxol-5-ylamino)-1-[1,1′-biphenyl]-4-yl-1-propanone, with the CAS number 477333-86-1, is a synthetic organic compound characterized by its complex structure, which includes a benzodioxole moiety and a biphenyl group. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the amino group, which can participate in hydrogen bonding and interact with biological targets. The ketone functional group in the propanone structure may contribute to its reactivity and stability under various conditions. Additionally, the compound's aromatic rings suggest it may possess significant hydrophobic characteristics, influencing its solubility and interaction with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Overall, the unique combination of structural features in this compound may lead to interesting chemical behavior and biological activity, warranting further investigation in medicinal chemistry.
Formula:C22H19NO3
InChI:InChI=1S/C22H19NO3/c24-20(12-13-23-19-10-11-21-22(14-19)26-15-25-21)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-11,14,23H,12-13,15H2
InChI key:InChIKey=KOGYDZOKSCKNCX-UHFFFAOYSA-N
SMILES:N(CCC(=O)C1=CC=C(C=C1)C2=CC=CC=C2)C=3C=C4C(=CC3)OCO4
Synonyms:
  • 3-(1,3-Benzodioxol-5-ylamino)-1-[1,1′-biphenyl]-4-yl-1-propanone
  • 1-Propanone, 3-(1,3-benzodioxol-5-ylamino)-1-[1,1′-biphenyl]-4-yl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.