
CAS 477333-94-1
:1-(4-Fluorophenyl)-3-[(3-nitrophenyl)amino]-1-propanone
Description:
1-(4-Fluorophenyl)-3-[(3-nitrophenyl)amino]-1-propanone, identified by its CAS number 477333-94-1, is an organic compound characterized by its complex structure featuring a propanone backbone substituted with both a fluorophenyl group and a nitrophenylamino group. This compound typically exhibits a solid state at room temperature and is likely to be sparingly soluble in water, while being more soluble in organic solvents due to its hydrophobic aromatic rings. The presence of the fluorine atom enhances its lipophilicity and may influence its biological activity, while the nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and reactivity can be influenced by the electronic effects of the substituents, which can affect its stability and interaction with biological targets. As with many organic compounds, safety precautions should be taken when handling this substance due to potential toxicity associated with its nitro and fluorine groups.
Formula:C15H13FN2O3
InChI:InChI=1S/C15H13FN2O3/c16-12-6-4-11(5-7-12)15(19)8-9-17-13-2-1-3-14(10-13)18(20)21/h1-7,10,17H,8-9H2
InChI key:InChIKey=VHMXUCFMTFIYBP-UHFFFAOYSA-N
SMILES:C(CCNC1=CC(N(=O)=O)=CC=C1)(=O)C2=CC=C(F)C=C2
Synonyms:- 1-Propanone, 1-(4-fluorophenyl)-3-[(3-nitrophenyl)amino]-
- 1-(4-Fluorophenyl)-3-[(3-nitrophenyl)amino]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.