
CAS 477334-20-6
:1-(4-Chlorophenyl)-3-[(4-fluorophenyl)sulfonyl]-1-propanone
Description:
1-(4-Chlorophenyl)-3-[(4-fluorophenyl)sulfonyl]-1-propanone, identified by its CAS number 477334-20-6, is a synthetic organic compound characterized by its unique structure that includes a propanone backbone substituted with both a chlorophenyl and a fluorophenyl sulfonyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential reactivity due to the presence of electron-withdrawing groups like the chlorophenyl and fluorophenyl moieties. It may be utilized in various chemical applications, including medicinal chemistry and material science, due to its potential biological activity and ability to participate in further chemical reactions. The sulfonyl group enhances its solubility in polar solvents, making it suitable for diverse formulations. Additionally, the presence of halogen atoms can influence its electronic properties, potentially affecting its reactivity and interaction with biological targets. Overall, this compound represents a class of sulfonyl-containing ketones that may have significant implications in pharmaceutical research and development.
Formula:C15H12ClFO3S
InChI:InChI=1S/C15H12ClFO3S/c16-12-3-1-11(2-4-12)15(18)9-10-21(19,20)14-7-5-13(17)6-8-14/h1-8H,9-10H2
InChI key:InChIKey=GXVRNXSUBVPDEA-UHFFFAOYSA-N
SMILES:S(CCC(=O)C1=CC=C(Cl)C=C1)(=O)(=O)C2=CC=C(F)C=C2
Synonyms:- 1-(4-Chlorophenyl)-3-[(4-fluorophenyl)sulfonyl]-1-propanone
- 1-Propanone, 1-(4-chlorophenyl)-3-[(4-fluorophenyl)sulfonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.