CAS 477334-32-0

3-[(4-Bromophenyl)sulfonyl]-1-(4-methylphenyl)-1-propanone

Description:

3-[(4-Bromophenyl)sulfonyl]-1-(4-methylphenyl)-1-propanone, identified by its CAS number 477334-32-0, is an organic compound characterized by its sulfonyl and ketone functional groups. This compound features a propanone backbone substituted with a 4-bromophenyl sulfonyl group and a 4-methylphenyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. The presence of the bromine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the sulfonyl group can influence the compound's polarity and reactivity, making it useful in synthetic organic chemistry. Its structural features suggest potential applications in pharmaceuticals or as an intermediate in organic synthesis. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₆H₁₅BrO₃S

InChI: InChI=1S/C16H15BrO3S/c1-12-2-4-13(5-3-12)16(18)10-11-21(19,20)15-8-6-14(17)7-9-15/h2-9H,10-11H2,1H3

InChI key: InChIKey=QNOJLKGLAQYUCR-UHFFFAOYSA-N

SMILES: S(CCC(=O)C1=CC=C(C)C=C1)(=O)(=O)C2=CC=C(Br)C=C2

Synonyms:

• 1-Propanone, 3-[(4-bromophenyl)sulfonyl]-1-(4-methylphenyl)-
• 3-[(4-Bromophenyl)sulfonyl]-1-(4-methylphenyl)-1-propanone