CAS 477334-41-1

1-(4-Bromophenyl)-3-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-1-propanone

Description:

1-(4-Bromophenyl)-3-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-1-propanone, with the CAS number 477334-41-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a bromophenyl group and a benzodioxin moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the bromine atom enhances its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. The benzodioxin structure may impart unique pharmacological properties, potentially influencing its interaction with biological targets. Additionally, the compound's molecular weight, solubility, and stability can vary based on environmental conditions and the presence of solvents. It is essential to handle this compound with care, as it may possess toxicological properties, and its safety profile should be evaluated in accordance with standard laboratory practices. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and material science.

Formula: C₁₇H₁₆BrNO₃

InChI: InChI=1S/C17H16BrNO3/c18-13-3-1-12(2-4-13)15(20)7-8-19-14-5-6-16-17(11-14)22-10-9-21-16/h1-6,11,19H,7-10H2

InChI key: InChIKey=CKZVMIXOFYKUCO-UHFFFAOYSA-N

SMILES: N(CCC(=O)C1=CC=C(Br)C=C1)C=2C=C3C(=CC2)OCCO3

Synonyms:

• 1-Propanone, 1-(4-bromophenyl)-3-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-
• 1-(4-Bromophenyl)-3-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-1-propanone