CAS 477334-43-3
:1-(4-Fluorophenyl)-3-[(4-fluorophenyl)thio]-1-propanone
Description:
1-(4-Fluorophenyl)-3-[(4-fluorophenyl)thio]-1-propanone, identified by its CAS number 477334-43-3, is an organic compound characterized by its unique structure that includes a propanone backbone substituted with two 4-fluorophenyl groups and a thioether linkage. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobicity due to the presence of fluorinated aromatic rings. The fluorine substituents can enhance the compound's lipophilicity and influence its electronic properties, potentially affecting its reactivity and interaction with biological systems. The thioether group may impart additional stability and alter the compound's solubility in various solvents. As a synthetic intermediate, it may be of interest in pharmaceutical chemistry and materials science, particularly in the development of novel compounds with specific biological activities or functional properties. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C15H12F2OS
InChI:InChI=1S/C15H12F2OS/c16-12-3-1-11(2-4-12)15(18)9-10-19-14-7-5-13(17)6-8-14/h1-8H,9-10H2
InChI key:InChIKey=LWHRFLYQNNEMSY-UHFFFAOYSA-N
SMILES:C(CCSC1=CC=C(F)C=C1)(=O)C2=CC=C(F)C=C2
Synonyms:- 1-Propanone, 1-(4-fluorophenyl)-3-[(4-fluorophenyl)thio]-
- 1-(4-Fluorophenyl)-3-[(4-fluorophenyl)thio]-1-propanone
- SALOR-INT L250902-1EA
- 1-(4-FLUOROPHENYL)-3-[(4-FLUOROPHENYL)SULFANYL]-1-PROPANONE
- 1-(4-Fluorophenyl)-3-[(4-fluorophenyl)sulfanyl]propan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.