CymitQuimica logo

CAS 477334-44-4

:

3-[(4-Fluorophenyl)thio]-1-(4-methoxyphenyl)-1-propanone

Description:
3-[(4-Fluorophenyl)thio]-1-(4-methoxyphenyl)-1-propanone, identified by its CAS number 477334-44-4, is an organic compound characterized by its unique molecular structure, which includes a propanone backbone substituted with both a fluorophenyl and a methoxyphenyl group. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the presence of the carbonyl group, which can engage in hydrogen bonding. The presence of the fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and lipophilicity. The methoxy group also contributes to the compound's overall polarity and can affect its solubility in various solvents. Additionally, the thioether linkage introduces sulfur into the structure, which may impart unique chemical reactivity and stability. Overall, this compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and functional properties.
Formula:C16H15FO2S
InChI:InChI=1S/C16H15FO2S/c1-19-14-6-2-12(3-7-14)16(18)10-11-20-15-8-4-13(17)5-9-15/h2-9H,10-11H2,1H3
InChI key:InChIKey=WNLVFMRPOMKBPE-UHFFFAOYSA-N
SMILES:C(CCSC1=CC=C(F)C=C1)(=O)C2=CC=C(OC)C=C2
Synonyms:
  • 3-[(4-Fluorophenyl)thio]-1-(4-methoxyphenyl)-1-propanone
  • 1-Propanone, 3-[(4-fluorophenyl)thio]-1-(4-methoxyphenyl)-
  • 3-[(4-FLUOROPHENYL)SULFANYL]-1-(4-METHOXYPHENYL)-1-PROPANONE
  • SALOR-INT L250910-1EA
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.