
CAS 477334-49-9
:1-(4-Fluorophenyl)-3-[(4-fluorophenyl)sulfonyl]-1-propanone
Description:
1-(4-Fluorophenyl)-3-[(4-fluorophenyl)sulfonyl]-1-propanone, identified by its CAS number 477334-49-9, is an organic compound characterized by its unique structure that includes a propanone moiety substituted with fluorophenyl and sulfonyl groups. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, which is common for many aromatic sulfonyl compounds. The presence of fluorine atoms in the phenyl rings enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The sulfonyl group contributes to its reactivity, potentially allowing for further chemical modifications. Additionally, this compound may exhibit specific pharmacological properties, which could be explored in drug development contexts. Its stability and reactivity profile would depend on the conditions of use, including temperature and the presence of other reactive species. Overall, this compound represents a class of sulfonyl-containing ketones that are valuable in various chemical applications, including synthesis and potential therapeutic uses.
Formula:C15H12F2O3S
InChI:InChI=1S/C15H12F2O3S/c16-12-3-1-11(2-4-12)15(18)9-10-21(19,20)14-7-5-13(17)6-8-14/h1-8H,9-10H2
InChI key:InChIKey=HTBJZJYVRVLFJT-UHFFFAOYSA-N
SMILES:S(CCC(=O)C1=CC=C(F)C=C1)(=O)(=O)C2=CC=C(F)C=C2
Synonyms:- 1-Propanone, 1-(4-fluorophenyl)-3-[(4-fluorophenyl)sulfonyl]-
- 1-(4-Fluorophenyl)-3-[(4-fluorophenyl)sulfonyl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.