CymitQuimica logo

CAS 477334-53-5

:

1-(4-Fluorophenyl)-3-[(4-methylphenyl)sulfonyl]-1-propanone

Description:
1-(4-Fluorophenyl)-3-[(4-methylphenyl)sulfonyl]-1-propanone, identified by its CAS number 477334-53-5, is an organic compound characterized by its unique molecular structure, which includes a propanone backbone substituted with a fluorophenyl group and a sulfonyl group attached to a methylphenyl moiety. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow solid at room temperature. It is likely to be soluble in organic solvents like ethanol and acetone, while having limited solubility in water due to its hydrophobic aromatic groups. The presence of the fluorine atom may impart specific electronic properties, potentially enhancing its reactivity or influencing its interaction with biological targets. Additionally, the sulfonyl group can enhance the compound's stability and may play a role in its biological activity, making it of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.
Formula:C16H15FO3S
InChI:InChI=1S/C16H15FO3S/c1-12-2-8-15(9-3-12)21(19,20)11-10-16(18)13-4-6-14(17)7-5-13/h2-9H,10-11H2,1H3
InChI key:InChIKey=SQNZHMVKRGDDNK-UHFFFAOYSA-N
SMILES:S(CCC(=O)C1=CC=C(F)C=C1)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:
  • 1-Propanone, 1-(4-fluorophenyl)-3-[(4-methylphenyl)sulfonyl]-
  • 1-(4-Fluorophenyl)-3-[(4-methylphenyl)sulfonyl]-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.