CAS 4774-17-8
:6-Methoxy-2(1H)-pyrazinone
Description:
6-Methoxy-2(1H)-pyrazinone, with the CAS number 4774-17-8, is a heterocyclic organic compound characterized by a pyrazinone core structure. This compound features a methoxy group (-OCH3) at the 6-position of the pyrazinone ring, which contributes to its chemical reactivity and solubility properties. It typically appears as a crystalline solid and is soluble in polar organic solvents. The presence of the pyrazinone moiety suggests potential applications in pharmaceuticals and agrochemicals, as pyrazinones are known for their biological activity, including antimicrobial and anti-inflammatory properties. The compound's molecular structure allows for various functionalization possibilities, making it a versatile intermediate in organic synthesis. Additionally, its stability under standard laboratory conditions makes it suitable for further chemical modifications. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C5H6N2O2
InChI:InChI=1S/C5H6N2O2/c1-9-5-3-6-2-4(8)7-5/h2-3H,1H3,(H,7,8)
InChI key:InChIKey=PJASVKBBHBEVPH-UHFFFAOYSA-N
SMILES:O(C)C=1NC(=O)C=NC1
Synonyms:- 2(1H)-Pyrazinone, 6-methoxy-
- 6-Methoxy-2(1H)-pyrazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
