CAS 477535-41-4
:3-Bromo-5-(trifluoromethyl)benzaldehyde
Description:
3-Bromo-5-(trifluoromethyl)benzaldehyde is an aromatic aldehyde characterized by the presence of a bromine atom and a trifluoromethyl group attached to a benzene ring. The molecular structure features a benzaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The bromine substituent, located at the meta position relative to the aldehyde, can influence the compound's electronic properties and reactivity, while the trifluoromethyl group, known for its strong electron-withdrawing effects, enhances the compound's lipophilicity and stability. This compound is typically used in various chemical reactions, including nucleophilic substitutions and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its unique combination of functional groups makes it a valuable building block in organic chemistry. Additionally, due to the presence of fluorine atoms, it may exhibit distinct physical properties, such as increased boiling point and altered solubility compared to non-fluorinated analogs. Safety precautions should be observed when handling this compound, as halogenated compounds can pose health and environmental risks.
Formula:C8H4BrF3O
InChI:InChI=1/C8H4BrF3O/c9-7-2-5(4-13)1-6(3-7)8(10,11)12/h1-4H
SMILES:c1c(cc(cc1C(F)(F)F)Br)C=O
Synonyms:- Benzaldehyde, 3-bromo-5-(trifluoromethyl)-
- 3-Bromo-5-trifluoromethylbenzaldehyde
- 3-Bromo-5-Trifluoromethyl benzaldehyde
- 3-Bromo-5-(trifluoromethyl)benzaldehyde97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-5-(trifluoromethyl)benzaldehyde
CAS:Formula:C8H4BrF3OPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:253.023-Bromo-5-(trifluoromethyl)benzaldehyde, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H4BrF3OPurity:97%Color and Shape:Liquid, Clear colorless to pale yellowMolecular weight:253.023-Bromo-5-(trifluoromethyl)benzaldehyde
CAS:Formula:C8H4BrF3OPurity:95%Color and Shape:LiquidMolecular weight:253.01603-Bromo-5-(trifluoromethyl)benzaldehyde
CAS:3-Bromo-5-(trifluoromethyl)benzaldehydeFormula:C8H4BrF3OPurity:98%Color and Shape: colorless liquid liquidMolecular weight:253.02g/mol3-Bromo-5-(trifluoromethyl)benzaldehyde
CAS:Formula:C8H4BrF3OPurity:95%Color and Shape:LiquidMolecular weight:253.018




