CAS 477575-60-3
:(2S)-N-Cyclopropyl-2-pyrrolidinecarboxamide
Description:
(2S)-N-Cyclopropyl-2-pyrrolidinecarboxamide is a chemical compound characterized by its unique structural features, including a cyclopropyl group and a pyrrolidine ring. This compound belongs to the class of amides, which are characterized by the presence of a carbonyl group (C=O) adjacent to a nitrogen atom. The specific stereochemistry indicated by the (2S) designation suggests that the molecule has a particular three-dimensional arrangement, which can significantly influence its biological activity and interactions. The cyclopropyl group contributes to the compound's rigidity and may affect its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may interact with biological targets such as receptors or enzymes. Its CAS number, 477575-60-3, serves as a unique identifier for regulatory and research purposes, facilitating the tracking of its properties and applications in scientific literature. Overall, the characteristics of this compound make it a subject of interest in various fields, including pharmaceuticals and organic synthesis.
Formula:C8H14N2O
InChI:InChI=1S/C8H14N2O/c11-8(10-6-3-4-6)7-2-1-5-9-7/h6-7,9H,1-5H2,(H,10,11)/t7-/m0/s1
InChI key:InChIKey=CWWHDEBHSXGQHY-ZETCQYMHSA-N
SMILES:C(NC1CC1)(=O)[C@@H]2CCCN2
Synonyms:- (S)-Pyrrolidine-2-carboxylic acid cyclopropylamide
- 2-Pyrrolidinecarboxamide, N-cyclopropyl-, (2S)-
- (2S)-N-Cyclopropylpyrrolidine-2-carboxamide
- (S)-N-Cyclopropylpyrrolidine-2-carboxamide
- (2S)-N-Cyclopropyl-2-pyrrolidinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.